C19H18O3 — CID 166111304
8-[(1R)-1-hydroxyethyl]-3,6-dimethyl-2-phenylchromen-4-one (PubChem CID 166111304) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 8-[(1R)-1-hydroxyethyl]-3,6-dimethyl-2-phenylchromen-4-one.
| Compound Name | 8-[(1R)-1-hydroxyethyl]-3,6-dimethyl-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 166111304 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 8-[(1R)-1-hydroxyethyl]-3,6-dimethyl-2-phenylchromen-4-one |
| SMILES | Cc1cc([C@@H](C)O)c2oc(-c3ccccc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C19H18O3/c1-11-9-15(13(3)20)19-16(10-11)17(21)12(2)18(22-19)14-7-5-4-6-8-14/h4-10,13,20H,1-3H3/t13-/m1/s1 |
| InChIKey | DYZVJUAAGNNLCR-CYBMUJFWSA-N |
| XLogP | 4.13 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |