C23H27NO2S — CID 170420560
8-[1-(tert-butylsulfanylamino)ethyl]-3,6-dimethyl-2-phenylchromen-4-one (PubChem CID 170420560) has the molecular formula C23H27NO2S and a molecular weight of 381.54 g/mol. Its IUPAC name is 8-[1-(tert-butylsulfanylamino)ethyl]-3,6-dimethyl-2-phenylchromen-4-one.
| Compound Name | 8-[1-(tert-butylsulfanylamino)ethyl]-3,6-dimethyl-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 170420560 |
| Molecular Formula | C23H27NO2S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 8-[1-(tert-butylsulfanylamino)ethyl]-3,6-dimethyl-2-phenylchromen-4-one |
| SMILES | Cc1cc(C(C)NSC(C)(C)C)c2oc(-c3ccccc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C23H27NO2S/c1-14-12-18(16(3)24-27-23(4,5)6)22-19(13-14)20(25)15(2)21(26-22)17-10-8-7-9-11-17/h7-13,16,24H,1-6H3 |
| InChIKey | WYZHGOVZKHDKRB-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|