C25H23N3O4 — CID 171611121
3-[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethoxy]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 171611121) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is 3-[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethoxy]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 3-[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethoxy]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 171611121 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 3-[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethoxy]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | Cc1cc([C@@H](C)Oc2cccnc2/C(N)=N/O)c2oc(-c3ccccc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C25H23N3O4/c1-14-12-18(16(3)31-20-10-7-11-27-21(20)25(26)28-30)24-19(13-14)22(29)15(2)23(32-24)17-8-5-4-6-9-17/h4-13,16,30H,1-3H3,(H2,26,28)/t16-/m1/s1 |
| InChIKey | DWLQHGUJLJFSEF-MRXNPFEDSA-N |
| XLogP | 4.71 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|