C25H24N4O3 — CID 174202646
3-[[1-deuterio-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 174202646) has the molecular formula C25H24N4O3 and a molecular weight of 429.50 g/mol. Its IUPAC name is 3-[[1-deuterio-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 3-[[1-deuterio-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 174202646 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 3-[[1-deuterio-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | [2H]C(C)(Nc1cccnc1C(N)=NO)c1cc(C)cc2c(=O)c(C)c(-c3ccccc3)oc12 |
| InChI | InChI=1S/C25H24N4O3/c1-14-12-18(16(3)28-20-10-7-11-27-21(20)25(26)29-31)24-19(13-14)22(30)15(2)23(32-24)17-8-5-4-6-9-17/h4-13,16,28,31H,1-3H3,(H2,26,29)/i16D |
| InChIKey | GEZDPIWZQRNVQI-QNLPYAOMSA-N |
| XLogP | 4.74 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|