C25H23ClN4O5S — CID 169270864
N-[[6-chloro-3-[[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-2-ylchromen-8-yl)ethyl]amino]-2-pyridinyl]sulfonyl]acetamide (PubChem CID 169270864) has the molecular formula C25H23ClN4O5S and a molecular weight of 527.00 g/mol. Its IUPAC name is N-[[6-chloro-3-[[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-2-ylchromen-8-yl)ethyl]amino]-2-pyridinyl]sulfonyl]acetamide.
| Compound Name | N-[[6-chloro-3-[[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-2-ylchromen-8-yl)ethyl]amino]-2-pyridinyl]sulfonyl]acetamide |
|---|---|
| PubChem CID | 169270864 |
| Molecular Formula | C25H23ClN4O5S |
| Molecular Weight | 527.00 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | N-[[6-chloro-3-[[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-2-ylchromen-8-yl)ethyl]amino]-2-pyridinyl]sulfonyl]acetamide |
| SMILES | CC(=O)NS(=O)(=O)c1nc(Cl)ccc1N[C@H](C)c1cc(C)cc2c(=O)c(C)c(-c3ccccn3)oc12 |
| InChI | InChI=1S/C25H23ClN4O5S/c1-13-11-17(15(3)28-20-8-9-21(26)29-25(20)36(33,34)30-16(4)31)24-18(12-13)22(32)14(2)23(35-24)19-7-5-6-10-27-19/h5-12,15,28H,1-4H3,(H,30,31)/t15-/m1/s1 |
| InChIKey | BFSKLWFNCCHBFT-OAHLLOKOSA-N |
| XLogP | 4.52 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.00 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|