C27H29ClN4O4S — CID 170421589
N-tert-butyl-6-chloro-3-[[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-2-ylchromen-8-yl)ethyl]amino]pyridine-2-sulfonamide (PubChem CID 170421589) has the molecular formula C27H29ClN4O4S and a molecular weight of 541.07 g/mol. Its IUPAC name is N-tert-butyl-6-chloro-3-[[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-2-ylchromen-8-yl)ethyl]amino]pyridine-2-sulfonamide.
| Compound Name | N-tert-butyl-6-chloro-3-[[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-2-ylchromen-8-yl)ethyl]amino]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 170421589 |
| Molecular Formula | C27H29ClN4O4S |
| Molecular Weight | 541.07 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | N-tert-butyl-6-chloro-3-[[(1R)-1-(3,6-dimethyl-4-oxo-2-pyridin-2-ylchromen-8-yl)ethyl]amino]pyridine-2-sulfonamide |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2S(=O)(=O)NC(C)(C)C)c2oc(-c3ccccn3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C27H29ClN4O4S/c1-15-13-18(25-19(14-15)23(33)16(2)24(36-25)20-9-7-8-12-29-20)17(3)30-21-10-11-22(28)31-26(21)37(34,35)32-27(4,5)6/h7-14,17,30,32H,1-6H3/t17-/m1/s1 |
| InChIKey | TZUWIWRAONOKBI-QGZVFWFLSA-N |
| XLogP | 5.77 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.07 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|