C26H26ClN7O5 — CID 174166875
3-[4-[8-[(1R)-1-[[6-chloro-2-[(Z)-N'-hydroxycarbamimidoyl]-3-pyridinyl]amino]ethyl]-3,6-dimethyl-4-oxochromen-2-yl]pyrazol-1-yl]azetidine-1-carboxylic acid (PubChem CID 174166875) has the molecular formula C26H26ClN7O5 and a molecular weight of 551.99 g/mol. Its IUPAC name is 3-[4-[8-[(1R)-1-[[6-chloro-2-[(Z)-N'-hydroxycarbamimidoyl]-3-pyridinyl]amino]ethyl]-3,6-dimethyl-4-oxochromen-2-yl]pyrazol-1-yl]azetidine-1-carboxylic acid.
| Compound Name | 3-[4-[8-[(1R)-1-[[6-chloro-2-[(Z)-N'-hydroxycarbamimidoyl]-3-pyridinyl]amino]ethyl]-3,6-dimethyl-4-oxochromen-2-yl]pyrazol-1-yl]azetidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174166875 |
| Molecular Formula | C26H26ClN7O5 |
| Molecular Weight | 551.99 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | 3-[4-[8-[(1R)-1-[[6-chloro-2-[(Z)-N'-hydroxycarbamimidoyl]-3-pyridinyl]amino]ethyl]-3,6-dimethyl-4-oxochromen-2-yl]pyrazol-1-yl]azetidine-1-carboxylic acid |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2/C(N)=N/O)c2oc(-c3cnn(C4CN(C(=O)O)C4)c3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C26H26ClN7O5/c1-12-6-17(14(3)30-19-4-5-20(27)31-21(19)25(28)32-38)24-18(7-12)22(35)13(2)23(39-24)15-8-29-34(9-15)16-10-33(11-16)26(36)37/h4-9,14,16,30,38H,10-11H2,1-3H3,(H2,28,32)(H,36,37)/t14-/m1/s1 |
| InChIKey | OQIJSRRTHVZMQI-CQSZACIVSA-N |
| XLogP | 4.12 |
| TPSA | 172.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.99 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|