C26H25ClN6O3 — CID 169154911
3-[1-[2-[4-amino-3-(methyliminomethyl)phenyl]-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-6-chloropyridine-2-carboxylic acid (PubChem CID 169154911) has the molecular formula C26H25ClN6O3 and a molecular weight of 504.98 g/mol. Its IUPAC name is 3-[1-[2-[4-amino-3-(methyliminomethyl)phenyl]-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-6-chloropyridine-2-carboxylic acid.
| Compound Name | 3-[1-[2-[4-amino-3-(methyliminomethyl)phenyl]-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-6-chloropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 169154911 |
| Molecular Formula | C26H25ClN6O3 |
| Molecular Weight | 504.98 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 3-[1-[2-[4-amino-3-(methyliminomethyl)phenyl]-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-6-chloropyridine-2-carboxylic acid |
| SMILES | C/N=C/c1cc(-c2nc3c(C(C)Nc4ccc(Cl)nc4C(=O)O)cc(C)cc3c(=O)n2C)ccc1N |
| InChI | InChI=1S/C26H25ClN6O3/c1-13-9-17(14(2)30-20-7-8-21(27)31-23(20)26(35)36)22-18(10-13)25(34)33(4)24(32-22)15-5-6-19(28)16(11-15)12-29-3/h5-12,14,30H,28H2,1-4H3,(H,35,36)/b29-12+ |
| InChIKey | UAWXHQHBJWHSOY-XKJRVUDJSA-N |
| XLogP | 4.46 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.98 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|