C24H22ClN5O3 — CID 169154948
3-[[(1R)-1-[2-(3-aminophenyl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethyl]amino]-6-chloropyridine-2-carboxylic acid (PubChem CID 169154948) has the molecular formula C24H22ClN5O3 and a molecular weight of 463.93 g/mol. Its IUPAC name is 3-[[(1R)-1-[2-(3-aminophenyl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethyl]amino]-6-chloropyridine-2-carboxylic acid.
| Compound Name | 3-[[(1R)-1-[2-(3-aminophenyl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethyl]amino]-6-chloropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 169154948 |
| Molecular Formula | C24H22ClN5O3 |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 3-[[(1R)-1-[2-(3-aminophenyl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethyl]amino]-6-chloropyridine-2-carboxylic acid |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2C(=O)O)c2nc(-c3cccc(N)c3)n(C)c(=O)c2c1 |
| InChI | InChI=1S/C24H22ClN5O3/c1-12-9-16(13(2)27-18-7-8-19(25)28-21(18)24(32)33)20-17(10-12)23(31)30(3)22(29-20)14-5-4-6-15(26)11-14/h4-11,13,27H,26H2,1-3H3,(H,32,33)/t13-/m1/s1 |
| InChIKey | PLJBPQRTSJUZJP-CYBMUJFWSA-N |
| XLogP | 4.41 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|