C25H20ClFN2O4 — CID 174163918
6-chloro-3-[1-[2-(3-fluoro-4-methylphenyl)-6-methyl-4-oxochromen-8-yl]ethylamino]pyridine-2-carboxylic acid (PubChem CID 174163918) has the molecular formula C25H20ClFN2O4 and a molecular weight of 466.90 g/mol. Its IUPAC name is 6-chloro-3-[1-[2-(3-fluoro-4-methylphenyl)-6-methyl-4-oxochromen-8-yl]ethylamino]pyridine-2-carboxylic acid.
| Compound Name | 6-chloro-3-[1-[2-(3-fluoro-4-methylphenyl)-6-methyl-4-oxochromen-8-yl]ethylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 174163918 |
| Molecular Formula | C25H20ClFN2O4 |
| Molecular Weight | 466.90 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 6-chloro-3-[1-[2-(3-fluoro-4-methylphenyl)-6-methyl-4-oxochromen-8-yl]ethylamino]pyridine-2-carboxylic acid |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2C(=O)O)c2oc(-c3ccc(C)c(F)c3)cc(=O)c2c1 |
| InChI | InChI=1S/C25H20ClFN2O4/c1-12-8-16(14(3)28-19-6-7-22(26)29-23(19)25(31)32)24-17(9-12)20(30)11-21(33-24)15-5-4-13(2)18(27)10-15/h4-11,14,28H,1-3H3,(H,31,32) |
| InChIKey | DQYVVECESDOXBA-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.90 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|