C21H21ClN2O5S — CID 156876534
6-chloro-3-[1-(2-ethylsulfinyl-3,6-dimethyl-4-oxochromen-8-yl)ethylamino]pyridine-2-carboxylic acid (PubChem CID 156876534) has the molecular formula C21H21ClN2O5S and a molecular weight of 448.93 g/mol. Its IUPAC name is 6-chloro-3-[1-(2-ethylsulfinyl-3,6-dimethyl-4-oxochromen-8-yl)ethylamino]pyridine-2-carboxylic acid.
| Compound Name | 6-chloro-3-[1-(2-ethylsulfinyl-3,6-dimethyl-4-oxochromen-8-yl)ethylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 156876534 |
| Molecular Formula | C21H21ClN2O5S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 6-chloro-3-[1-(2-ethylsulfinyl-3,6-dimethyl-4-oxochromen-8-yl)ethylamino]pyridine-2-carboxylic acid |
| SMILES | CCS(=O)c1oc2c(C(C)Nc3ccc(Cl)nc3C(=O)O)cc(C)cc2c(=O)c1C |
| InChI | InChI=1S/C21H21ClN2O5S/c1-5-30(28)21-11(3)18(25)14-9-10(2)8-13(19(14)29-21)12(4)23-15-6-7-16(22)24-17(15)20(26)27/h6-9,12,23H,5H2,1-4H3,(H,26,27) |
| InChIKey | RAWPJIDVSFZOQL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|