C22H24ClN5O4 — CID 169270372
3-[1-[2-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylic acid (PubChem CID 169270372) has the molecular formula C22H24ClN5O4 and a molecular weight of 457.92 g/mol. Its IUPAC name is 3-[1-[2-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylic acid.
| Compound Name | 3-[1-[2-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 169270372 |
| Molecular Formula | C22H24ClN5O4 |
| Molecular Weight | 457.92 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 3-[1-[2-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylic acid |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2C(=O)O)c2oc(/C(N)=C/N(C)N)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C22H24ClN5O4/c1-10-7-13(12(3)26-16-5-6-17(23)27-18(16)22(30)31)21-14(8-10)19(29)11(2)20(32-21)15(24)9-28(4)25/h5-9,12,26H,24-25H2,1-4H3,(H,30,31)/b15-9- |
| InChIKey | YEHSBRUPBCTSIX-DHDCSXOGSA-N |
| XLogP | 3.39 |
| TPSA | 147.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.92 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|