C27H31ClN2O4 — CID 169268883
tert-butyl 6-chloro-3-[[(1R)-1-(2-cyclobutyl-3,6-dimethyl-4-oxochromen-8-yl)ethyl]amino]pyridine-2-carboxylate (PubChem CID 169268883) has the molecular formula C27H31ClN2O4 and a molecular weight of 483.01 g/mol. Its IUPAC name is tert-butyl 6-chloro-3-[[(1R)-1-(2-cyclobutyl-3,6-dimethyl-4-oxochromen-8-yl)ethyl]amino]pyridine-2-carboxylate.
| Compound Name | tert-butyl 6-chloro-3-[[(1R)-1-(2-cyclobutyl-3,6-dimethyl-4-oxochromen-8-yl)ethyl]amino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 169268883 |
| Molecular Formula | C27H31ClN2O4 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | tert-butyl 6-chloro-3-[[(1R)-1-(2-cyclobutyl-3,6-dimethyl-4-oxochromen-8-yl)ethyl]amino]pyridine-2-carboxylate |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2C(=O)OC(C)(C)C)c2oc(C3CCC3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C27H31ClN2O4/c1-14-12-18(25-19(13-14)23(31)15(2)24(33-25)17-8-7-9-17)16(3)29-20-10-11-21(28)30-22(20)26(32)34-27(4,5)6/h10-13,16-17,29H,7-9H2,1-6H3/t16-/m1/s1 |
| InChIKey | GVSXYXORNMFZSI-MRXNPFEDSA-N |
| XLogP | 6.85 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|