C23H24ClFN6O3 — CID 169268938
(Z)-2-[8-[1-[[6-chloro-2-[(Z)-N'-hydroxycarbamimidoyl]-3-pyridinyl]amino]ethyl]-3,6-dimethyl-4-oxochromen-2-yl]-3-(methylamino)prop-2-enimidoyl fluoride (PubChem CID 169268938) has the molecular formula C23H24ClFN6O3 and a molecular weight of 486.94 g/mol. Its IUPAC name is (Z)-2-[8-[1-[[6-chloro-2-[(Z)-N'-hydroxycarbamimidoyl]-3-pyridinyl]amino]ethyl]-3,6-dimethyl-4-oxochromen-2-yl]-3-(methylamino)prop-2-enimidoyl fluoride.
| Compound Name | (Z)-2-[8-[1-[[6-chloro-2-[(Z)-N'-hydroxycarbamimidoyl]-3-pyridinyl]amino]ethyl]-3,6-dimethyl-4-oxochromen-2-yl]-3-(methylamino)prop-2-enimidoyl fluoride |
|---|---|
| PubChem CID | 169268938 |
| Molecular Formula | C23H24ClFN6O3 |
| Molecular Weight | 486.94 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | (Z)-2-[8-[1-[[6-chloro-2-[(Z)-N'-hydroxycarbamimidoyl]-3-pyridinyl]amino]ethyl]-3,6-dimethyl-4-oxochromen-2-yl]-3-(methylamino)prop-2-enimidoyl fluoride |
| SMILES | [H]/N=C(F)/C(=C\NC)c1oc2c(C(C)Nc3ccc(Cl)nc3/C(N)=N/O)cc(C)cc2c(=O)c1C |
| InChI | InChI=1S/C23H24ClFN6O3/c1-10-7-13(12(3)29-16-5-6-17(24)30-18(16)23(27)31-33)21-14(8-10)19(32)11(2)20(34-21)15(9-28-4)22(25)26/h5-9,12,26,28-29,33H,1-4H3,(H2,27,31)/b15-9-,26-22- |
| InChIKey | MMMCYNSIZUCYFW-DJDVASEISA-N |
| XLogP | 4.23 |
| TPSA | 149.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.94 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|