C28H27ClN4O5 — CID 166778694
3-[1-[2-[5-[amino(hydroxy)methyl]-1,3-dihydroisoindol-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylic acid (PubChem CID 166778694) has the molecular formula C28H27ClN4O5 and a molecular weight of 535.00 g/mol. Its IUPAC name is 3-[1-[2-[5-[amino(hydroxy)methyl]-1,3-dihydroisoindol-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylic acid.
| Compound Name | 3-[1-[2-[5-[amino(hydroxy)methyl]-1,3-dihydroisoindol-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 166778694 |
| Molecular Formula | C28H27ClN4O5 |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 3-[1-[2-[5-[amino(hydroxy)methyl]-1,3-dihydroisoindol-2-yl]-3,6-dimethyl-4-oxochromen-8-yl]ethylamino]-6-chloropyridine-2-carboxylic acid |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2C(=O)O)c2oc(N3Cc4ccc(C(N)O)cc4C3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C28H27ClN4O5/c1-13-8-19(15(3)31-21-6-7-22(29)32-23(21)28(36)37)25-20(9-13)24(34)14(2)27(38-25)33-11-17-5-4-16(26(30)35)10-18(17)12-33/h4-10,15,26,31,35H,11-12,30H2,1-3H3,(H,36,37) |
| InChIKey | XJBXRIUKGCGBGM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 141.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|