C19H18O5S — CID 166111472
[(1S)-1-(6-methyl-4-oxo-2-phenylchromen-8-yl)ethyl] methanesulfonate (PubChem CID 166111472) has the molecular formula C19H18O5S and a molecular weight of 358.42 g/mol. Its IUPAC name is [(1S)-1-(6-methyl-4-oxo-2-phenylchromen-8-yl)ethyl] methanesulfonate.
| Compound Name | [(1S)-1-(6-methyl-4-oxo-2-phenylchromen-8-yl)ethyl] methanesulfonate |
|---|---|
| PubChem CID | 166111472 |
| Molecular Formula | C19H18O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | [(1S)-1-(6-methyl-4-oxo-2-phenylchromen-8-yl)ethyl] methanesulfonate |
| SMILES | Cc1cc([C@H](C)OS(C)(=O)=O)c2oc(-c3ccccc3)cc(=O)c2c1 |
| InChI | InChI=1S/C19H18O5S/c1-12-9-15(13(2)24-25(3,21)22)19-16(10-12)17(20)11-18(23-19)14-7-5-4-6-8-14/h4-11,13H,1-3H3/t13-/m0/s1 |
| InChIKey | FPNGCQGONYKKEX-ZDUSSCGKSA-N |
| XLogP | 3.81 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|