C24H21N3O5 — CID 175824662
2-amino-3-[1-[2-(2-methoxypyrimidin-5-yl)-6-methyl-4-oxochromen-8-yl]ethyl]benzoic acid (PubChem CID 175824662) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is 2-amino-3-[1-[2-(2-methoxypyrimidin-5-yl)-6-methyl-4-oxochromen-8-yl]ethyl]benzoic acid.
| Compound Name | 2-amino-3-[1-[2-(2-methoxypyrimidin-5-yl)-6-methyl-4-oxochromen-8-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 175824662 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-amino-3-[1-[2-(2-methoxypyrimidin-5-yl)-6-methyl-4-oxochromen-8-yl]ethyl]benzoic acid |
| SMILES | COc1ncc(-c2cc(=O)c3cc(C)cc(C(C)c4cccc(C(=O)O)c4N)c3o2)cn1 |
| InChI | InChI=1S/C24H21N3O5/c1-12-7-17(13(2)15-5-4-6-16(21(15)25)23(29)30)22-18(8-12)19(28)9-20(32-22)14-10-26-24(31-3)27-11-14/h4-11,13H,25H2,1-3H3,(H,29,30) |
| InChIKey | PBJFWFLEAFCZKO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|