C17H13ClN4O4 — CID 16611111
3-[1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl]-4-oxophthalazine-1-carboxylic acid (PubChem CID 16611111) has the molecular formula C17H13ClN4O4 and a molecular weight of 372.77 g/mol. Its IUPAC name is 3-[1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl]-4-oxophthalazine-1-carboxylic acid.
| Compound Name | 3-[1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl]-4-oxophthalazine-1-carboxylic acid |
|---|---|
| PubChem CID | 16611111 |
| Molecular Formula | C17H13ClN4O4 |
| Molecular Weight | 372.77 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 3-[1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl]-4-oxophthalazine-1-carboxylic acid |
| SMILES | CC(C(=O)Nc1cccnc1Cl)n1nc(C(=O)O)c2ccccc2c1=O |
| InChI | InChI=1S/C17H13ClN4O4/c1-9(15(23)20-12-7-4-8-19-14(12)18)22-16(24)11-6-3-2-5-10(11)13(21-22)17(25)26/h2-9H,1H3,(H,20,23)(H,25,26) |
| InChIKey | PAFGNJMLJZZWBU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.77 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|