C19H16N3O5- — CID 2627386
3-[(2R)-1-(2-methoxyanilino)-1-oxopropan-2-yl]-4-oxophthalazine-1-carboxylate (PubChem CID 2627386) has the molecular formula C19H16N3O5- and a molecular weight of 366.35 g/mol. Its IUPAC name is 3-[(2R)-1-(2-methoxyanilino)-1-oxopropan-2-yl]-4-oxophthalazine-1-carboxylate.
| Compound Name | 3-[(2R)-1-(2-methoxyanilino)-1-oxopropan-2-yl]-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 2627386 |
| Molecular Formula | C19H16N3O5- |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 3-[(2R)-1-(2-methoxyanilino)-1-oxopropan-2-yl]-4-oxophthalazine-1-carboxylate |
| SMILES | COc1ccccc1NC(=O)[C@@H](C)n1nc(C(=O)[O-])c2ccccc2c1=O |
| InChI | InChI=1S/C19H17N3O5/c1-11(17(23)20-14-9-5-6-10-15(14)27-2)22-18(24)13-8-4-3-7-12(13)16(21-22)19(25)26/h3-11H,1-2H3,(H,20,23)(H,25,26)/p-1/t11-/m1/s1 |
| InChIKey | PBYGATUSNZTUES-LLVKDONJSA-M |
| XLogP | 0.97 |
| TPSA | 113.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |