C17H18N3O4- — CID 2627397
3-[(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl]-4-oxophthalazine-1-carboxylate (PubChem CID 2627397) has the molecular formula C17H18N3O4- and a molecular weight of 328.35 g/mol. Its IUPAC name is 3-[(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl]-4-oxophthalazine-1-carboxylate.
| Compound Name | 3-[(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl]-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 2627397 |
| Molecular Formula | C17H18N3O4- |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 3-[(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl]-4-oxophthalazine-1-carboxylate |
| SMILES | C[C@H](C(=O)NC1CCCC1)n1nc(C(=O)[O-])c2ccccc2c1=O |
| InChI | InChI=1S/C17H19N3O4/c1-10(15(21)18-11-6-2-3-7-11)20-16(22)13-9-5-4-8-12(13)14(19-20)17(23)24/h4-5,8-11H,2-3,6-7H2,1H3,(H,18,21)(H,23,24)/p-1/t10-/m1/s1 |
| InChIKey | YDSROLZUNGPDTQ-SNVBAGLBSA-M |
| XLogP | 0.38 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |