C14H11N2O4- — CID 2682482
4-oxo-3-[(1S)-2-oxocyclopentyl]phthalazine-1-carboxylate (PubChem CID 2682482) has the molecular formula C14H11N2O4- and a molecular weight of 271.25 g/mol. Its IUPAC name is 4-oxo-3-[(1S)-2-oxocyclopentyl]phthalazine-1-carboxylate.
| Compound Name | 4-oxo-3-[(1S)-2-oxocyclopentyl]phthalazine-1-carboxylate |
|---|---|
| PubChem CID | 2682482 |
| Molecular Formula | C14H11N2O4- |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 4-oxo-3-[(1S)-2-oxocyclopentyl]phthalazine-1-carboxylate |
| SMILES | O=C([O-])c1nn([C@H]2CCCC2=O)c(=O)c2ccccc12 |
| InChI | InChI=1S/C14H12N2O4/c17-11-7-3-6-10(11)16-13(18)9-5-2-1-4-8(9)12(15-16)14(19)20/h1-2,4-5,10H,3,6-7H2,(H,19,20)/p-1/t10-/m0/s1 |
| InChIKey | MULIGICFBUACHS-JTQLQIEISA-M |
| XLogP | 0.05 |
| TPSA | 92.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |