C23H15N2O4- — CID 8006172
4-oxo-3-[(1R)-2-oxo-1,2-diphenylethyl]phthalazine-1-carboxylate (PubChem CID 8006172) has the molecular formula C23H15N2O4- and a molecular weight of 383.38 g/mol. Its IUPAC name is 4-oxo-3-[(1R)-2-oxo-1,2-diphenylethyl]phthalazine-1-carboxylate.
| Compound Name | 4-oxo-3-[(1R)-2-oxo-1,2-diphenylethyl]phthalazine-1-carboxylate |
|---|---|
| PubChem CID | 8006172 |
| Molecular Formula | C23H15N2O4- |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 4-oxo-3-[(1R)-2-oxo-1,2-diphenylethyl]phthalazine-1-carboxylate |
| SMILES | O=C([O-])c1nn([C@@H](C(=O)c2ccccc2)c2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C23H16N2O4/c26-21(16-11-5-2-6-12-16)20(15-9-3-1-4-10-15)25-22(27)18-14-8-7-13-17(18)19(24-25)23(28)29/h1-14,20H,(H,28,29)/p-1/t20-/m1/s1 |
| InChIKey | JEOIPYRHWOCUII-HXUWFJFHSA-M |
| XLogP | 2.23 |
| TPSA | 92.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |