C13H9N2O5- — CID 2352500
4-oxo-3-[(3S)-2-oxooxolan-3-yl]phthalazine-1-carboxylate (PubChem CID 2352500) has the molecular formula C13H9N2O5- and a molecular weight of 273.22 g/mol. Its IUPAC name is 4-oxo-3-[(3S)-2-oxooxolan-3-yl]phthalazine-1-carboxylate.
| Compound Name | 4-oxo-3-[(3S)-2-oxooxolan-3-yl]phthalazine-1-carboxylate |
|---|---|
| PubChem CID | 2352500 |
| Molecular Formula | C13H9N2O5- |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 4-oxo-3-[(3S)-2-oxooxolan-3-yl]phthalazine-1-carboxylate |
| SMILES | O=C([O-])c1nn([C@H]2CCOC2=O)c(=O)c2ccccc12 |
| InChI | InChI=1S/C13H10N2O5/c16-11-8-4-2-1-3-7(8)10(12(17)18)14-15(11)9-5-6-20-13(9)19/h1-4,9H,5-6H2,(H,17,18)/p-1/t9-/m0/s1 |
| InChIKey | USULJSZZUOHOBY-VIFPVBQESA-M |
| XLogP | -0.75 |
| TPSA | 101.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |