C32H34KNO4P- — CID 166111131
potassium;3-[4-[8-[1-(2-carboxyanilino)ethyl]-3,6-dimethyl-4-oxochromen-2-yl]phenyl]prop-2-enyl-methylphosphanide;ethane (PubChem CID 166111131) has the molecular formula C32H34KNO4P- and a molecular weight of 566.70 g/mol. Its IUPAC name is potassium;3-[4-[8-[1-(2-carboxyanilino)ethyl]-3,6-dimethyl-4-oxochromen-2-yl]phenyl]prop-2-enyl-methylphosphanide;ethane.
| Compound Name | potassium;3-[4-[8-[1-(2-carboxyanilino)ethyl]-3,6-dimethyl-4-oxochromen-2-yl]phenyl]prop-2-enyl-methylphosphanide;ethane |
|---|---|
| PubChem CID | 166111131 |
| Molecular Formula | C32H34KNO4P- |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | potassium;3-[4-[8-[1-(2-carboxyanilino)ethyl]-3,6-dimethyl-4-oxochromen-2-yl]phenyl]prop-2-enyl-methylphosphanide;ethane |
| SMILES | CC.C[P-]C/C=[C-]/c1ccc(-c2oc3c(C(C)Nc4ccccc4C(=O)O)cc(C)cc3c(=O)c2C)cc1.[K+] |
| InChI | InChI=1S/C30H28NO4P.C2H6.K/c1-18-16-24(20(3)31-26-10-6-5-9-23(26)30(33)34)29-25(17-18)27(32)19(2)28(35-29)22-13-11-21(12-14-22)8-7-15-36-4;1-2;/h5-7,9-14,16-17,20,31H,15H2,1-4H3,(H,33,34);1-2H3;/q-2;;+1 |
| InChIKey | KQLSXYJXKURWKL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|