C30H29NO4P- — CID 166111132
3-[4-[8-[1-(2-carboxyanilino)ethyl]-3,6-dimethyl-4-oxochromen-2-yl]phenyl]prop-2-enyl-methylphosphanide (PubChem CID 166111132) has the molecular formula C30H29NO4P- and a molecular weight of 498.54 g/mol. Its IUPAC name is 3-[4-[8-[1-(2-carboxyanilino)ethyl]-3,6-dimethyl-4-oxochromen-2-yl]phenyl]prop-2-enyl-methylphosphanide.
| Compound Name | 3-[4-[8-[1-(2-carboxyanilino)ethyl]-3,6-dimethyl-4-oxochromen-2-yl]phenyl]prop-2-enyl-methylphosphanide |
|---|---|
| PubChem CID | 166111132 |
| Molecular Formula | C30H29NO4P- |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 3-[4-[8-[1-(2-carboxyanilino)ethyl]-3,6-dimethyl-4-oxochromen-2-yl]phenyl]prop-2-enyl-methylphosphanide |
| SMILES | C[P-]CC=Cc1ccc(-c2oc3c(C(C)Nc4ccccc4C(=O)O)cc(C)cc3c(=O)c2C)cc1 |
| InChI | InChI=1S/C30H29NO4P/c1-18-16-24(20(3)31-26-10-6-5-9-23(26)30(33)34)29-25(17-18)27(32)19(2)28(35-29)22-13-11-21(12-14-22)8-7-15-36-4/h5-14,16-17,20,31H,15H2,1-4H3,(H,33,34)/q-1 |
| InChIKey | QAQDGIHZOBFLQZ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|