C21H29Al3N4O2 — CID 166114666
CID 166114666 (PubChem CID 166114666) has the molecular formula C21H29Al3N4O2 and a molecular weight of 450.44 g/mol.
| Compound Name | CID 166114666 |
|---|---|
| PubChem CID | 166114666 |
| Molecular Formula | C21H29Al3N4O2 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | — |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCC1CN(C[Al])CCN(C[Al])CCN1C[Al] |
| InChI | InChI=1S/C21H29N4O2.3Al/c1-22-12-13-23(2)16-17(24(3)15-14-22)8-6-7-11-25-20(26)18-9-4-5-10-19(18)21(25)27;;;/h4-5,9-10,17H,1-3,6-8,11-16H2;;; |
| InChIKey | NYXQJMPUUVNJHW-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|