C11H21N3O — CID 166115066
1,4-dimethyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde (PubChem CID 166115066) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 1,4-dimethyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde.
| Compound Name | 1,4-dimethyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde |
|---|---|
| PubChem CID | 166115066 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1,4-dimethyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde |
| SMILES | CN1CCN(C)C2(CCN(C=O)CC2)C1 |
| InChI | InChI=1S/C11H21N3O/c1-12-7-8-13(2)11(9-12)3-5-14(10-15)6-4-11/h10H,3-9H2,1-2H3 |
| InChIKey | NAIPVFFKEUDFPY-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|