C12H23N3O — CID 166115180
1-ethyl-4-methyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde (PubChem CID 166115180) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 1-ethyl-4-methyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde.
| Compound Name | 1-ethyl-4-methyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde |
|---|---|
| PubChem CID | 166115180 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 1-ethyl-4-methyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde |
| SMILES | CCN1CCN(C)CC12CCN(C=O)CC2 |
| InChI | InChI=1S/C12H23N3O/c1-3-15-9-8-13(2)10-12(15)4-6-14(11-16)7-5-12/h11H,3-10H2,1-2H3 |
| InChIKey | DGTMOIDGLDAUSY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|