C21H21ClN4OS — CID 166118251
6-chloro-2-(2-methyl-4-sulfanylanilino)-8-spiro[2.4]heptan-7-ylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 166118251) has the molecular formula C21H21ClN4OS and a molecular weight of 412.95 g/mol. Its IUPAC name is 6-chloro-2-(2-methyl-4-sulfanylanilino)-8-spiro[2.4]heptan-7-ylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-chloro-2-(2-methyl-4-sulfanylanilino)-8-spiro[2.4]heptan-7-ylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 166118251 |
| Molecular Formula | C21H21ClN4OS |
| Molecular Weight | 412.95 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 6-chloro-2-(2-methyl-4-sulfanylanilino)-8-spiro[2.4]heptan-7-ylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc(S)ccc1Nc1ncc2cc(Cl)c(=O)n(C3CCCC34CC4)c2n1 |
| InChI | InChI=1S/C21H21ClN4OS/c1-12-9-14(28)4-5-16(12)24-20-23-11-13-10-15(22)19(27)26(18(13)25-20)17-3-2-6-21(17)7-8-21/h4-5,9-11,17,28H,2-3,6-8H2,1H3,(H,23,24,25) |
| InChIKey | PNNAITZSXMOFCK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.95 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|