C22H26ClN5OS — CID 170951887
6-chloro-8-cyclopentyl-2-[2-methyl-4-(propan-2-ylamino)sulfanylanilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 170951887) has the molecular formula C22H26ClN5OS and a molecular weight of 444.00 g/mol. Its IUPAC name is 6-chloro-8-cyclopentyl-2-[2-methyl-4-(propan-2-ylamino)sulfanylanilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-chloro-8-cyclopentyl-2-[2-methyl-4-(propan-2-ylamino)sulfanylanilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 170951887 |
| Molecular Formula | C22H26ClN5OS |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 6-chloro-8-cyclopentyl-2-[2-methyl-4-(propan-2-ylamino)sulfanylanilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc(SNC(C)C)ccc1Nc1ncc2cc(Cl)c(=O)n(C3CCCC3)c2n1 |
| InChI | InChI=1S/C22H26ClN5OS/c1-13(2)27-30-17-8-9-19(14(3)10-17)25-22-24-12-15-11-18(23)21(29)28(20(15)26-22)16-6-4-5-7-16/h8-13,16,27H,4-7H2,1-3H3,(H,24,25,26) |
| InChIKey | MJXSOSXRNIOBBE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.00 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|