C22H25F2N5O2S — CID 170952228
8-cyclopentyl-6-(difluoromethyl)-2-[4-(2-hydroxyethylamino)sulfanyl-2-methylanilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 170952228) has the molecular formula C22H25F2N5O2S and a molecular weight of 461.54 g/mol. Its IUPAC name is 8-cyclopentyl-6-(difluoromethyl)-2-[4-(2-hydroxyethylamino)sulfanyl-2-methylanilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclopentyl-6-(difluoromethyl)-2-[4-(2-hydroxyethylamino)sulfanyl-2-methylanilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 170952228 |
| Molecular Formula | C22H25F2N5O2S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 8-cyclopentyl-6-(difluoromethyl)-2-[4-(2-hydroxyethylamino)sulfanyl-2-methylanilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc(SNCCO)ccc1Nc1ncc2cc(C(F)F)c(=O)n(C3CCCC3)c2n1 |
| InChI | InChI=1S/C22H25F2N5O2S/c1-13-10-16(32-26-8-9-30)6-7-18(13)27-22-25-12-14-11-17(19(23)24)21(31)29(20(14)28-22)15-4-2-3-5-15/h6-7,10-12,15,19,26,30H,2-5,8-9H2,1H3,(H,25,27,28) |
| InChIKey | VRVOQESXVUNOFB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|