C22H28ClN5O2S — CID 170953533
N-[5-[(E)-2-chloroprop-1-enyl]-2-[4-(2-hydroxyethylamino)sulfanyl-2-methylanilino]pyrimidin-4-yl]-N-cyclopentylformamide (PubChem CID 170953533) has the molecular formula C22H28ClN5O2S and a molecular weight of 462.02 g/mol. Its IUPAC name is N-[5-[(E)-2-chloroprop-1-enyl]-2-[4-(2-hydroxyethylamino)sulfanyl-2-methylanilino]pyrimidin-4-yl]-N-cyclopentylformamide.
| Compound Name | N-[5-[(E)-2-chloroprop-1-enyl]-2-[4-(2-hydroxyethylamino)sulfanyl-2-methylanilino]pyrimidin-4-yl]-N-cyclopentylformamide |
|---|---|
| PubChem CID | 170953533 |
| Molecular Formula | C22H28ClN5O2S |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | N-[5-[(E)-2-chloroprop-1-enyl]-2-[4-(2-hydroxyethylamino)sulfanyl-2-methylanilino]pyrimidin-4-yl]-N-cyclopentylformamide |
| SMILES | C/C(Cl)=C\c1cnc(Nc2ccc(SNCCO)cc2C)nc1N(C=O)C1CCCC1 |
| InChI | InChI=1S/C22H28ClN5O2S/c1-15-11-19(31-25-9-10-29)7-8-20(15)26-22-24-13-17(12-16(2)23)21(27-22)28(14-30)18-5-3-4-6-18/h7-8,11-14,18,25,29H,3-6,9-10H2,1-2H3,(H,24,26,27)/b16-12+ |
| InChIKey | CJXIPWWUYMZQHC-FOWTUZBSSA-N |
| XLogP | 4.62 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|