C27H33N5O5 — CID 166118876
tert-butyl N-amino-N-[2-[(2,4-dimethoxyphenyl)methyl]-7-(imidazol-1-ylmethyl)-1-oxo-3,4-dihydroisoquinolin-5-yl]carbamate (PubChem CID 166118876) has the molecular formula C27H33N5O5 and a molecular weight of 507.59 g/mol. Its IUPAC name is tert-butyl N-amino-N-[2-[(2,4-dimethoxyphenyl)methyl]-7-(imidazol-1-ylmethyl)-1-oxo-3,4-dihydroisoquinolin-5-yl]carbamate.
| Compound Name | tert-butyl N-amino-N-[2-[(2,4-dimethoxyphenyl)methyl]-7-(imidazol-1-ylmethyl)-1-oxo-3,4-dihydroisoquinolin-5-yl]carbamate |
|---|---|
| PubChem CID | 166118876 |
| Molecular Formula | C27H33N5O5 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | tert-butyl N-amino-N-[2-[(2,4-dimethoxyphenyl)methyl]-7-(imidazol-1-ylmethyl)-1-oxo-3,4-dihydroisoquinolin-5-yl]carbamate |
| SMILES | COc1ccc(CN2CCc3c(cc(Cn4ccnc4)cc3N(N)C(=O)OC(C)(C)C)C2=O)c(OC)c1 |
| InChI | InChI=1S/C27H33N5O5/c1-27(2,3)37-26(34)32(28)23-13-18(15-30-11-9-29-17-30)12-22-21(23)8-10-31(25(22)33)16-19-6-7-20(35-4)14-24(19)36-5/h6-7,9,11-14,17H,8,10,15-16,28H2,1-5H3 |
| InChIKey | WOZJDNLCOPPUET-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|