C19H25N3OS — CID 166120126
2-ethyl-N-[3-(4-methoxycyclohexa-2,4-dien-1-yl)propyl]-6-methylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 166120126) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is 2-ethyl-N-[3-(4-methoxycyclohexa-2,4-dien-1-yl)propyl]-6-methylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-ethyl-N-[3-(4-methoxycyclohexa-2,4-dien-1-yl)propyl]-6-methylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166120126 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-ethyl-N-[3-(4-methoxycyclohexa-2,4-dien-1-yl)propyl]-6-methylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1nc(NCCCC2C=CC(OC)=CC2)c2cc(C)sc2n1 |
| InChI | InChI=1S/C19H25N3OS/c1-4-17-21-18(16-12-13(2)24-19(16)22-17)20-11-5-6-14-7-9-15(23-3)10-8-14/h7,9-10,12,14H,4-6,8,11H2,1-3H3,(H,20,21,22) |
| InChIKey | DQHOVXWDQBEUNW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|