C18H21N3S — CID 137431957
2-ethyl-6-methyl-N-(3-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 137431957) has the molecular formula C18H21N3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 2-ethyl-6-methyl-N-(3-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-ethyl-6-methyl-N-(3-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 137431957 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-ethyl-6-methyl-N-(3-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1nc(NCCCc2ccccc2)c2cc(C)sc2n1 |
| InChI | InChI=1S/C18H21N3S/c1-3-16-20-17(15-12-13(2)22-18(15)21-16)19-11-7-10-14-8-5-4-6-9-14/h4-6,8-9,12H,3,7,10-11H2,1-2H3,(H,19,20,21) |
| InChIKey | JMFHPUKSQVURSF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|