C22H24N4O — CID 166122684
4-(2,3-dihydro-1H-inden-5-yl)-6,7-dimethyl-2-(oxan-4-yl)pteridine (PubChem CID 166122684) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-5-yl)-6,7-dimethyl-2-(oxan-4-yl)pteridine.
| Compound Name | 4-(2,3-dihydro-1H-inden-5-yl)-6,7-dimethyl-2-(oxan-4-yl)pteridine |
|---|---|
| PubChem CID | 166122684 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-5-yl)-6,7-dimethyl-2-(oxan-4-yl)pteridine |
| SMILES | Cc1nc2nc(C3CCOCC3)nc(-c3ccc4c(c3)CCC4)c2nc1C |
| InChI | InChI=1S/C22H24N4O/c1-13-14(2)24-22-20(23-13)19(18-7-6-15-4-3-5-17(15)12-18)25-21(26-22)16-8-10-27-11-9-16/h6-7,12,16H,3-5,8-11H2,1-2H3 |
| InChIKey | OHXFDKZIAMEZLN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |