About 1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane
1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane (PubChem CID 166123385) has the molecular formula C20H26Cl2F4
and a molecular weight of 413.33 g/mol. Its IUPAC name is 1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane.
Molecular Properties
| Compound Name | 1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane |
| PubChem CID | 166123385 |
| Molecular Formula | C20H26Cl2F4 |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane |
| SMILES | CC.CC.CC(C)c1ccc(Cl)c(F)c1F.Cc1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C9H9ClF2.C7H5ClF2.2C2H6/c1-5(2)6-3-4-7(10)9(12)8(6)11;1-4-2-7(10)5(8)3-6(4)9;2*1-2/h3-5H,1-2H3;2-3H,1H3;2*1-2H3 |
| InChIKey | LXGTVDIUSCSJHI-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane?
The IUPAC name of 1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane (CID 166123385) is 1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane.
What is the SMILES notation for 1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane?
The canonical SMILES for 1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane is CC.CC.CC(C)c1ccc(Cl)c(F)c1F.Cc1cc(F)c(Cl)cc1F.
What is the InChIKey of 1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane?
The InChIKey is LXGTVDIUSCSJHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClF2.C7H5ClF2.2C2H6/c1-5(2)6-3-4-7(10)9(12)8(6)11;1-4-2-7(10)5(8)3-6(4)9;2*1-2/h3-5H,1-2H3;2-3H,1H3;2*1-2H3.
What are the key properties of 1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane?
1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane has a molecular weight of 413.33 g/mol, XLogP of 8.72, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane is sourced from PubChem (CID 166123385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).