C20H26Cl2F4 — CID 166123385
1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane (PubChem CID 166123385) has the molecular formula C20H26Cl2F4 and a molecular weight of 413.33 g/mol. Its IUPAC name is 1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane.
| Compound Name | 1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane |
|---|---|
| PubChem CID | 166123385 |
| Molecular Formula | C20H26Cl2F4 |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 1-chloro-2,5-difluoro-4-methylbenzene;1-chloro-2,3-difluoro-4-propan-2-ylbenzene;ethane |
| SMILES | CC.CC.CC(C)c1ccc(Cl)c(F)c1F.Cc1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C9H9ClF2.C7H5ClF2.2C2H6/c1-5(2)6-3-4-7(10)9(12)8(6)11;1-4-2-7(10)5(8)3-6(4)9;2*1-2/h3-5H,1-2H3;2-3H,1H3;2*1-2H3 |
| InChIKey | LXGTVDIUSCSJHI-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|