C21H28ClFN6O4S2 — CID 166129628
1-(2-chloro-3-pyridinyl)ethyl N-[4-[5-(dimethylaminosulfanylperoxy)-3-fluoro-2-pyridinyl]-1-methylpyrazol-5-yl]carbamate;ethane;sulfane (PubChem CID 166129628) has the molecular formula C21H28ClFN6O4S2 and a molecular weight of 547.08 g/mol. Its IUPAC name is 1-(2-chloro-3-pyridinyl)ethyl N-[4-[5-(dimethylaminosulfanylperoxy)-3-fluoro-2-pyridinyl]-1-methylpyrazol-5-yl]carbamate;ethane;sulfane.
| Compound Name | 1-(2-chloro-3-pyridinyl)ethyl N-[4-[5-(dimethylaminosulfanylperoxy)-3-fluoro-2-pyridinyl]-1-methylpyrazol-5-yl]carbamate;ethane;sulfane |
|---|---|
| PubChem CID | 166129628 |
| Molecular Formula | C21H28ClFN6O4S2 |
| Molecular Weight | 547.08 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | 1-(2-chloro-3-pyridinyl)ethyl N-[4-[5-(dimethylaminosulfanylperoxy)-3-fluoro-2-pyridinyl]-1-methylpyrazol-5-yl]carbamate;ethane;sulfane |
| SMILES | CC.CC(OC(=O)Nc1c(-c2ncc(OOSN(C)C)cc2F)cnn1C)c1cccnc1Cl.S |
| InChI | InChI=1S/C19H20ClFN6O4S.C2H6.H2S/c1-11(13-6-5-7-22-17(13)20)29-19(28)25-18-14(10-24-27(18)4)16-15(21)8-12(9-23-16)30-31-32-26(2)3;1-2;/h5-11H,1-4H3,(H,25,28);1-2H3;1H2 |
| InChIKey | SWYGFTWGAOGBLQ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.08 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|