C9H7Cl2F2NO2 — CID 166132527
methyl 2-(2-amino-3,6-dichlorophenyl)-2,2-difluoroacetate (PubChem CID 166132527) has the molecular formula C9H7Cl2F2NO2 and a molecular weight of 270.06 g/mol. Its IUPAC name is methyl 2-(2-amino-3,6-dichlorophenyl)-2,2-difluoroacetate.
| Compound Name | methyl 2-(2-amino-3,6-dichlorophenyl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 166132527 |
| Molecular Formula | C9H7Cl2F2NO2 |
| Molecular Weight | 270.06 g/mol |
| Exact Mass | 268.98 |
| IUPAC Name | methyl 2-(2-amino-3,6-dichlorophenyl)-2,2-difluoroacetate |
| SMILES | COC(=O)C(F)(F)c1c(Cl)ccc(Cl)c1N |
| InChI | InChI=1S/C9H7Cl2F2NO2/c1-16-8(15)9(12,13)6-4(10)2-3-5(11)7(6)14/h2-3H,14H2,1H3 |
| InChIKey | KIFNITHLGHQMCB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.06 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|