C22H33FN2O3 — CID 166132813
tert-butyl N-ethyl-N-[5-fluoro-2-methyl-3-(1-oxo-2-piperidin-1-ylpropan-2-yl)phenyl]carbamate (PubChem CID 166132813) has the molecular formula C22H33FN2O3 and a molecular weight of 392.52 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[5-fluoro-2-methyl-3-(1-oxo-2-piperidin-1-ylpropan-2-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[5-fluoro-2-methyl-3-(1-oxo-2-piperidin-1-ylpropan-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 166132813 |
| Molecular Formula | C22H33FN2O3 |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | tert-butyl N-ethyl-N-[5-fluoro-2-methyl-3-(1-oxo-2-piperidin-1-ylpropan-2-yl)phenyl]carbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)c1cc(F)cc(C(C)(C=O)N2CCCCC2)c1C |
| InChI | InChI=1S/C22H33FN2O3/c1-7-25(20(27)28-21(3,4)5)19-14-17(23)13-18(16(19)2)22(6,15-26)24-11-9-8-10-12-24/h13-15H,7-12H2,1-6H3 |
| InChIKey | TZFMEYTXSJAVNX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|