C34H30FN5O2 — CID 166135176
3-[4-(4-aminopiperidin-1-yl)phenyl]-5-cyano-N-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]benzamide (PubChem CID 166135176) has the molecular formula C34H30FN5O2 and a molecular weight of 559.65 g/mol. Its IUPAC name is 3-[4-(4-aminopiperidin-1-yl)phenyl]-5-cyano-N-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]benzamide.
| Compound Name | 3-[4-(4-aminopiperidin-1-yl)phenyl]-5-cyano-N-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 166135176 |
| Molecular Formula | C34H30FN5O2 |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | 3-[4-(4-aminopiperidin-1-yl)phenyl]-5-cyano-N-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]benzamide |
| SMILES | N#Cc1cc(C(=O)N[C@@H](c2cc3ccccc3[nH]2)c2cc(F)ccc2O)cc(-c2ccc(N3CCC(N)CC3)cc2)c1 |
| InChI | InChI=1S/C34H30FN5O2/c35-26-7-10-32(41)29(19-26)33(31-18-23-3-1-2-4-30(23)38-31)39-34(42)25-16-21(20-36)15-24(17-25)22-5-8-28(9-6-22)40-13-11-27(37)12-14-40/h1-10,15-19,27,33,38,41H,11-14,37H2,(H,39,42)/t33-/m1/s1 |
| InChIKey | URESXPOMOZHWAJ-MGBGTMOVSA-N |
| XLogP | 6.00 |
| TPSA | 118.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|