C36H34F2N4O7 — CID 166136208
methyl 4-[[2-(12-cyano-3,22-difluoro-7,17-dioxa-24-azatetracyclo[17.3.1.12,6.09,14]tetracosa-1(22),2,4,6(24),9(14),10,12,19(23),20-nonaen-20-yl)acetyl]amino]-3-(2-methoxyethoxy)-5-(methylamino)benzoate (PubChem CID 166136208) has the molecular formula C36H34F2N4O7 and a molecular weight of 672.69 g/mol. Its IUPAC name is methyl 4-[[2-(12-cyano-3,22-difluoro-7,17-dioxa-24-azatetracyclo[17.3.1.12,6.09,14]tetracosa-1(22),2,4,6(24),9(14),10,12,19(23),20-nonaen-20-yl)acetyl]amino]-3-(2-methoxyethoxy)-5-(methylamino)benzoate.
| Compound Name | methyl 4-[[2-(12-cyano-3,22-difluoro-7,17-dioxa-24-azatetracyclo[17.3.1.12,6.09,14]tetracosa-1(22),2,4,6(24),9(14),10,12,19(23),20-nonaen-20-yl)acetyl]amino]-3-(2-methoxyethoxy)-5-(methylamino)benzoate |
|---|---|
| PubChem CID | 166136208 |
| Molecular Formula | C36H34F2N4O7 |
| Molecular Weight | 672.69 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | methyl 4-[[2-(12-cyano-3,22-difluoro-7,17-dioxa-24-azatetracyclo[17.3.1.12,6.09,14]tetracosa-1(22),2,4,6(24),9(14),10,12,19(23),20-nonaen-20-yl)acetyl]amino]-3-(2-methoxyethoxy)-5-(methylamino)benzoate |
| SMILES | CNc1cc(C(=O)OC)cc(OCCOC)c1NC(=O)Cc1cc(F)c2cc1COCCc1cc(C#N)ccc1COc1ccc(F)c-2n1 |
| InChI | InChI=1S/C36H34F2N4O7/c1-40-30-15-25(36(44)46-3)16-31(48-11-10-45-2)35(30)41-32(43)17-24-14-29(38)27-13-26(24)19-47-9-8-22-12-21(18-39)4-5-23(22)20-49-33-7-6-28(37)34(27)42-33/h4-7,12-16,40H,8-11,17,19-20H2,1-3H3,(H,41,43) |
| InChIKey | INBWTDCEGGSVPU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 141.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.69 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|