C22H21N3O4 — CID 166138708
(19S)-7-amino-10-butyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 166138708) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is (19S)-7-amino-10-butyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-7-amino-10-butyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 166138708 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (19S)-7-amino-10-butyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | CCCCc1c2c(nc3ccc(N)cc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@H]3O |
| InChI | InChI=1S/C22H21N3O4/c1-2-3-4-12-13-7-11(23)5-6-17(13)24-19-15(12)9-25-18(19)8-14-16(21(25)27)10-29-22(28)20(14)26/h5-8,20,26H,2-4,9-10,23H2,1H3/t20-/m0/s1 |
| InChIKey | XFHRTFQALSNGDC-FQEVSTJZSA-N |
| XLogP | 2.44 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|