C22H17ClN2O6 — CID 167175256
14-(3-chloropropyl)-5-hydroxy-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaene-6,10-dione (PubChem CID 167175256) has the molecular formula C22H17ClN2O6 and a molecular weight of 440.84 g/mol. Its IUPAC name is 14-(3-chloropropyl)-5-hydroxy-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaene-6,10-dione.
| Compound Name | 14-(3-chloropropyl)-5-hydroxy-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaene-6,10-dione |
|---|---|
| PubChem CID | 167175256 |
| Molecular Formula | C22H17ClN2O6 |
| Molecular Weight | 440.84 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 14-(3-chloropropyl)-5-hydroxy-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaene-6,10-dione |
| SMILES | O=C1OCc2c(cc3n(c2=O)Cc2c-3nc3cc4c(cc3c2CCCCl)OCO4)C1O |
| InChI | InChI=1S/C22H17ClN2O6/c23-3-1-2-10-11-5-17-18(31-9-30-17)6-15(11)24-19-13(10)7-25-16(19)4-12-14(21(25)27)8-29-22(28)20(12)26/h4-6,20,26H,1-3,7-9H2 |
| InChIKey | CKBMNSJFRHYZJW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.84 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|