C22H14N2O7 — CID 170276746
(5S)-5-hydroxy-14-(3-hydroxyprop-1-ynyl)-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaene-6,10-dione (PubChem CID 170276746) has the molecular formula C22H14N2O7 and a molecular weight of 418.36 g/mol. Its IUPAC name is (5S)-5-hydroxy-14-(3-hydroxyprop-1-ynyl)-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaene-6,10-dione.
| Compound Name | (5S)-5-hydroxy-14-(3-hydroxyprop-1-ynyl)-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaene-6,10-dione |
|---|---|
| PubChem CID | 170276746 |
| Molecular Formula | C22H14N2O7 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (5S)-5-hydroxy-14-(3-hydroxyprop-1-ynyl)-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaene-6,10-dione |
| SMILES | O=C1OCc2c(cc3n(c2=O)Cc2c-3nc3cc4c(cc3c2C#CCO)OCO4)[C@@H]1O |
| InChI | InChI=1S/C22H14N2O7/c25-3-1-2-10-11-5-17-18(31-9-30-17)6-15(11)23-19-13(10)7-24-16(19)4-12-14(21(24)27)8-29-22(28)20(12)26/h4-6,20,25-26H,3,7-9H2/t20-/m0/s1 |
| InChIKey | JUVIBMZIJWRGAD-FQEVSTJZSA-N |
| XLogP | 0.59 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|