C24H21N3O4 — CID 170276916
(19S)-10-[4-(ethylamino)but-1-ynyl]-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione (PubChem CID 170276916) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is (19S)-10-[4-(ethylamino)but-1-ynyl]-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-10-[4-(ethylamino)but-1-ynyl]-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 170276916 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | (19S)-10-[4-(ethylamino)but-1-ynyl]-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
| SMILES | CCNCCC#Cc1c2c(nc3ccccc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@H]3O |
| InChI | InChI=1S/C24H21N3O4/c1-2-25-10-6-5-7-14-15-8-3-4-9-19(15)26-21-17(14)12-27-20(21)11-16-18(23(27)29)13-31-24(30)22(16)28/h3-4,8-9,11,22,25,28H,2,6,10,12-13H2,1H3/t22-/m0/s1 |
| InChIKey | KVNVXZZMHQOPHL-QFIPXVFZSA-N |
| XLogP | 1.87 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|