C31H27F3N6O3 — CID 166140000
1-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidin-4-yl]piperazin-2-one (PubChem CID 166140000) has the molecular formula C31H27F3N6O3 and a molecular weight of 588.59 g/mol. Its IUPAC name is 1-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidin-4-yl]piperazin-2-one.
| Compound Name | 1-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidin-4-yl]piperazin-2-one |
|---|---|
| PubChem CID | 166140000 |
| Molecular Formula | C31H27F3N6O3 |
| Molecular Weight | 588.59 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 1-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidin-4-yl]piperazin-2-one |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(N5CCNCC5=O)nc(OCC56CCCN5CC(F)C6)nc4c3F)c12 |
| InChI | InChI=1S/C31H27F3N6O3/c1-2-20-23(33)5-4-17-10-19(41)11-21(25(17)20)27-26(34)28-22(13-36-27)29(40-9-7-35-14-24(40)42)38-30(37-28)43-16-31-6-3-8-39(31)15-18(32)12-31/h1,4-5,10-11,13,18,35,41H,3,6-9,12,14-16H2 |
| InChIKey | DDDIBRCKKYGWBM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.59 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|