C25H29FN2O5S2 — CID 166140103
tert-butyl-[(E)-1-[2-ethoxycarbonyl-3-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-1H-indol-7-yl]ethylideneamino]-oxidosulfanium (PubChem CID 166140103) has the molecular formula C25H29FN2O5S2 and a molecular weight of 520.65 g/mol. Its IUPAC name is tert-butyl-[(E)-1-[2-ethoxycarbonyl-3-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-1H-indol-7-yl]ethylideneamino]-oxidosulfanium.
| Compound Name | tert-butyl-[(E)-1-[2-ethoxycarbonyl-3-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-1H-indol-7-yl]ethylideneamino]-oxidosulfanium |
|---|---|
| PubChem CID | 166140103 |
| Molecular Formula | C25H29FN2O5S2 |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | tert-butyl-[(E)-1-[2-ethoxycarbonyl-3-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-1H-indol-7-yl]ethylideneamino]-oxidosulfanium |
| SMILES | CCOC(=O)c1[nH]c2c(/C(C)=N/[S+]([O-])C(C)(C)C)cccc2c1-c1ccc(CS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C25H29FN2O5S2/c1-7-33-24(29)23-21(16-11-12-17(20(26)13-16)14-35(6,31)32)19-10-8-9-18(22(19)27-23)15(2)28-34(30)25(3,4)5/h8-13,27H,7,14H2,1-6H3/b28-15+ |
| InChIKey | DLCNVWDDEJJEFE-RWPZCVJISA-N |
| XLogP | 4.97 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|