C13H17F4NO — CID 166140446
ethane;N-[3-fluoro-2-methyl-4-(trifluoromethyl)phenyl]propanamide (PubChem CID 166140446) has the molecular formula C13H17F4NO and a molecular weight of 279.28 g/mol. Its IUPAC name is ethane;N-[3-fluoro-2-methyl-4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | ethane;N-[3-fluoro-2-methyl-4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 166140446 |
| Molecular Formula | C13H17F4NO |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | ethane;N-[3-fluoro-2-methyl-4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC.CCC(=O)Nc1ccc(C(F)(F)F)c(F)c1C |
| InChI | InChI=1S/C11H11F4NO.C2H6/c1-3-9(17)16-8-5-4-7(11(13,14)15)10(12)6(8)2;1-2/h4-5H,3H2,1-2H3,(H,16,17);1-2H3 |
| InChIKey | VBQNLXOVRMQOKC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |