C25H34N6O5 — CID 166140547
tert-butyl 5-[2-(3,6-dihydro-2H-pyran-4-yl)-5-ethyl-7-oxo-4-(2-oxoethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-2,5-diazabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 166140547) has the molecular formula C25H34N6O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is tert-butyl 5-[2-(3,6-dihydro-2H-pyran-4-yl)-5-ethyl-7-oxo-4-(2-oxoethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-2,5-diazabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | tert-butyl 5-[2-(3,6-dihydro-2H-pyran-4-yl)-5-ethyl-7-oxo-4-(2-oxoethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-2,5-diazabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 166140547 |
| Molecular Formula | C25H34N6O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | tert-butyl 5-[2-(3,6-dihydro-2H-pyran-4-yl)-5-ethyl-7-oxo-4-(2-oxoethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-2,5-diazabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | CCc1c(N2CCN(C(=O)OC(C)(C)C)C3CCC32)c(=O)n2nc(C3=CCOCC3)nc2n1CC=O |
| InChI | InChI=1S/C25H34N6O5/c1-5-17-20(28-10-11-30(19-7-6-18(19)28)24(34)36-25(2,3)4)22(33)31-23(29(17)12-13-32)26-21(27-31)16-8-14-35-15-9-16/h8,13,18-19H,5-7,9-12,14-15H2,1-4H3 |
| InChIKey | WMSKNMGPNLYXLV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 111.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|